C11H17N3O4 — CID 161308300
(3aR,4R,5R,6aS)-4-[(3R)-4-amino-3-nitrosobutyl]-5-nitroso-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 161308300) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(3R)-4-amino-3-nitrosobutyl]-5-nitroso-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(3R)-4-amino-3-nitrosobutyl]-5-nitroso-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 161308300 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(3R)-4-amino-3-nitrosobutyl]-5-nitroso-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | NC[C@@H](CC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1N=O)N=O |
| InChI | InChI=1S/C11H17N3O4/c12-5-6(13-16)1-2-7-8-3-11(15)18-10(8)4-9(7)14-17/h6-10H,1-5,12H2/t6-,7-,8-,9-,10+/m1/s1 |
| InChIKey | VIOAKIKULGJBSC-IGORNWKESA-N |
| XLogP | 0.95 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |