C20H24N3+ — CID 161308524
1-(1-adamantyl)-2-methyl-5H-[1,2,4]triazolo[5,1-a]isoindol-1-ium (PubChem CID 161308524) has the molecular formula C20H24N3+ and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-methyl-5H-[1,2,4]triazolo[5,1-a]isoindol-1-ium.
| Compound Name | 1-(1-adamantyl)-2-methyl-5H-[1,2,4]triazolo[5,1-a]isoindol-1-ium |
|---|---|
| PubChem CID | 161308524 |
| Molecular Formula | C20H24N3+ |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 1-(1-adamantyl)-2-methyl-5H-[1,2,4]triazolo[5,1-a]isoindol-1-ium |
| SMILES | Cc1nn2c([n+]1C13CC4CC(CC(C4)C1)C3)-c1ccccc1C2 |
| InChI | InChI=1S/C20H24N3/c1-13-21-22-12-17-4-2-3-5-18(17)19(22)23(13)20-9-14-6-15(10-20)8-16(7-14)11-20/h2-5,14-16H,6-12H2,1H3/q+1 |
| InChIKey | GYPFJEOLUNTDHZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|