About 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid
5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 161310018) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| PubChem CID | 161310018 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC=C(CO)C1 |
| InChI | InChI=1S/C7H11NO3/c9-5-6-2-1-3-8(4-6)7(10)11/h2,9H,1,3-5H2,(H,10,11) |
| InChIKey | VITKHHXFVVFMRZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The IUPAC name of 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid (CID 161310018) is 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid.
What is the SMILES notation for 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The canonical SMILES for 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid is O=C(O)N1CCC=C(CO)C1.
What is the InChIKey of 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The InChIKey is VITKHHXFVVFMRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c9-5-6-2-1-3-8(4-6)7(10)11/h2,9H,1,3-5H2,(H,10,11).
What are the key properties of 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid?
5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid is sourced from PubChem (CID 161310018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).