About N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine
N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine (PubChem CID 161310262) has the molecular formula C12H30N2O2
and a molecular weight of 234.38 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine.
Molecular Properties
| Compound Name | N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine |
| PubChem CID | 161310262 |
| Molecular Formula | C12H30N2O2 |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine |
| SMILES | CCCN.CCCNCC(OCC)OCC |
| InChI | InChI=1S/C9H21NO2.C3H9N/c1-4-7-10-8-9(11-5-2)12-6-3;1-2-3-4/h9-10H,4-8H2,1-3H3;2-4H2,1H3 |
| InChIKey | VIUCFLVYQOHLMK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine?
The IUPAC name of N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine (CID 161310262) is N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine.
What is the SMILES notation for N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine?
The canonical SMILES for N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine is CCCN.CCCNCC(OCC)OCC.
What is the InChIKey of N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine?
The InChIKey is VIUCFLVYQOHLMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO2.C3H9N/c1-4-7-10-8-9(11-5-2)12-6-3;1-2-3-4/h9-10H,4-8H2,1-3H3;2-4H2,1H3.
What are the key properties of N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine?
N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine has a molecular weight of 234.38 g/mol, XLogP of 1.74, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-diethoxyethyl)propan-1-amine;propan-1-amine is sourced from PubChem (CID 161310262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).