C30H26F12N4O8S4 — CID 161310533
1-benzyl-4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium;bis(bis(trifluoromethylsulfonyl)azanide) (PubChem CID 161310533) has the molecular formula C30H26F12N4O8S4 and a molecular weight of 926.80 g/mol. Its IUPAC name is 1-benzyl-4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium;bis(bis(trifluoromethylsulfonyl)azanide).
| Compound Name | 1-benzyl-4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium;bis(bis(trifluoromethylsulfonyl)azanide) |
|---|---|
| PubChem CID | 161310533 |
| Molecular Formula | C30H26F12N4O8S4 |
| Molecular Weight | 926.80 g/mol |
| Exact Mass | 926.04 |
| IUPAC Name | 1-benzyl-4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium;bis(bis(trifluoromethylsulfonyl)azanide) |
| SMILES | Cc1cc(C)c(-[n+]2ccc(-c3cc[n+](Cc4ccccc4)cc3)cc2)c(C)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H26N2.2C2F6NO4S2/c1-20-17-21(2)26(22(3)18-20)28-15-11-25(12-16-28)24-9-13-27(14-10-24)19-23-7-5-4-6-8-23;2*3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-18H,19H2,1-3H3;;/q+2;2*-1 |
| InChIKey | VIVBYPSQUURVOH-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 172.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.80 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|