C13H18N2O4S — CID 161311528
ethyl 5-cyclopent-3-en-1-yl-2-ethyl-1,1-dioxo-1,2,6-thiadiazine-3-carboxylate (PubChem CID 161311528) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is ethyl 5-cyclopent-3-en-1-yl-2-ethyl-1,1-dioxo-1,2,6-thiadiazine-3-carboxylate.
| Compound Name | ethyl 5-cyclopent-3-en-1-yl-2-ethyl-1,1-dioxo-1,2,6-thiadiazine-3-carboxylate |
|---|---|
| PubChem CID | 161311528 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | ethyl 5-cyclopent-3-en-1-yl-2-ethyl-1,1-dioxo-1,2,6-thiadiazine-3-carboxylate |
| SMILES | CCOC(=O)C1=CC(C2CC=CC2)=NS(=O)(=O)N1CC |
| InChI | InChI=1S/C13H18N2O4S/c1-3-15-12(13(16)19-4-2)9-11(14-20(15,17)18)10-7-5-6-8-10/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | VIYKJYQFRQMDLF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|