C17H12 — CID 161312364
1-(2-bicyclo[2.2.1]hepta-1,3,5-trienyl)naphthalene (PubChem CID 161312364) has the molecular formula C17H12 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hepta-1,3,5-trienyl)naphthalene.
| Compound Name | 1-(2-bicyclo[2.2.1]hepta-1,3,5-trienyl)naphthalene |
|---|---|
| PubChem CID | 161312364 |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hepta-1,3,5-trienyl)naphthalene |
| SMILES | C1=CC2=C(c3cccc4ccccc34)C=C1C2 |
| InChI | InChI=1S/C17H12/c1-2-6-15-13(4-1)5-3-7-16(15)17-11-12-8-9-14(17)10-12/h1-9,11H,10H2 |
| InChIKey | VJBDWSFQZWEXLU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |