C37H36IN13O2 — CID 161312407
N-(2-aminophenyl)-4-iodobenzamide;4-[(E)-2-(4,6-diamino-1,3,5-triazin-2-yl)ethenyl]-N-(2-methylphenyl)benzamide;6-ethenyl-1,3,5-triazine-2,4-diamine (PubChem CID 161312407) has the molecular formula C37H36IN13O2 and a molecular weight of 821.69 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-iodobenzamide;4-[(E)-2-(4,6-diamino-1,3,5-triazin-2-yl)ethenyl]-N-(2-methylphenyl)benzamide;6-ethenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | N-(2-aminophenyl)-4-iodobenzamide;4-[(E)-2-(4,6-diamino-1,3,5-triazin-2-yl)ethenyl]-N-(2-methylphenyl)benzamide;6-ethenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 161312407 |
| Molecular Formula | C37H36IN13O2 |
| Molecular Weight | 821.69 g/mol |
| Exact Mass | 821.22 |
| IUPAC Name | N-(2-aminophenyl)-4-iodobenzamide;4-[(E)-2-(4,6-diamino-1,3,5-triazin-2-yl)ethenyl]-N-(2-methylphenyl)benzamide;6-ethenyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=Cc1nc(N)nc(N)n1.Cc1ccccc1NC(=O)c1ccc(/C=C/c2nc(N)nc(N)n2)cc1.Nc1ccccc1NC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C19H18N6O.C13H11IN2O.C5H7N5/c1-12-4-2-3-5-15(12)22-17(26)14-9-6-13(7-10-14)8-11-16-23-18(20)25-19(21)24-16;14-10-7-5-9(6-8-10)13(17)16-12-4-2-1-3-11(12)15;1-2-3-8-4(6)10-5(7)9-3/h2-11H,1H3,(H,22,26)(H4,20,21,23,24,25);1-8H,15H2,(H,16,17);2H,1H2,(H4,6,7,8,9,10)/b11-8+;; |
| InChIKey | VJBHPWAJWFSERI-OHENRDTHSA-N |
| XLogP | 5.57 |
| TPSA | 265.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|