C26H32N5O9P — CID 161312607
propan-2-yl (2S)-3-[[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-prop-1-ynyloxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 161312607) has the molecular formula C26H32N5O9P and a molecular weight of 589.54 g/mol. Its IUPAC name is propan-2-yl (2S)-3-[[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-prop-1-ynyloxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | propan-2-yl (2S)-3-[[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-prop-1-ynyloxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 161312607 |
| Molecular Formula | C26H32N5O9P |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | propan-2-yl (2S)-3-[[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-prop-1-ynyloxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | CC#CC1(O)[C@@H](O)[C@@H](CO[P@@](=O)(C[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C26H32N5O9P/c1-5-11-26(35)20(32)18(39-24(26)31-14-28-19-21(31)29-25(27)30-22(19)33)12-37-41(36,40-17-9-7-6-8-10-17)13-16(4)23(34)38-15(2)3/h6-10,14-16,18,20,24,32,35H,12-13H2,1-4H3,(H3,27,29,30,33)/t16-,18-,20+,24-,26?,41+/m1/s1 |
| InChIKey | GPXGMNGGGFPIEA-TUJDKNKFSA-N |
| XLogP | 1.59 |
| TPSA | 201.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|