C22H24F3IN2O4 — CID 161313246
(3R,4R)-1-(2,6-difluoro-4-hydroxyphenyl)-4-[(8-fluoro-3,4-dihydroquinolin-5-yl)oxymethyl]piperidine-3,4-diol;iodomethane (PubChem CID 161313246) has the molecular formula C22H24F3IN2O4 and a molecular weight of 564.34 g/mol. Its IUPAC name is (3R,4R)-1-(2,6-difluoro-4-hydroxyphenyl)-4-[(8-fluoro-3,4-dihydroquinolin-5-yl)oxymethyl]piperidine-3,4-diol;iodomethane.
| Compound Name | (3R,4R)-1-(2,6-difluoro-4-hydroxyphenyl)-4-[(8-fluoro-3,4-dihydroquinolin-5-yl)oxymethyl]piperidine-3,4-diol;iodomethane |
|---|---|
| PubChem CID | 161313246 |
| Molecular Formula | C22H24F3IN2O4 |
| Molecular Weight | 564.34 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | (3R,4R)-1-(2,6-difluoro-4-hydroxyphenyl)-4-[(8-fluoro-3,4-dihydroquinolin-5-yl)oxymethyl]piperidine-3,4-diol;iodomethane |
| SMILES | CI.Oc1cc(F)c(N2CC[C@@](O)(COc3ccc(F)c4c3CCC=N4)[C@H](O)C2)c(F)c1 |
| InChI | InChI=1S/C21H21F3N2O4.CH3I/c22-14-3-4-17(13-2-1-6-25-19(13)14)30-11-21(29)5-7-26(10-18(21)28)20-15(23)8-12(27)9-16(20)24;1-2/h3-4,6,8-9,18,27-29H,1-2,5,7,10-11H2;1H3/t18-,21-;/m1./s1 |
| InChIKey | VJDXRGSOBBBRLE-IUFJOMBNSA-N |
| XLogP | 3.89 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|