C42H46N2O3 — CID 161313614
6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[4-(6,6-dimethylcyclohexen-1-yl)phenyl]methanone;4-(6,6-dimethylcyclohexen-1-yl)benzoic acid (PubChem CID 161313614) has the molecular formula C42H46N2O3 and a molecular weight of 626.84 g/mol. Its IUPAC name is 6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[4-(6,6-dimethylcyclohexen-1-yl)phenyl]methanone;4-(6,6-dimethylcyclohexen-1-yl)benzoic acid.
| Compound Name | 6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[4-(6,6-dimethylcyclohexen-1-yl)phenyl]methanone;4-(6,6-dimethylcyclohexen-1-yl)benzoic acid |
|---|---|
| PubChem CID | 161313614 |
| Molecular Formula | C42H46N2O3 |
| Molecular Weight | 626.84 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | 6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[4-(6,6-dimethylcyclohexen-1-yl)phenyl]methanone;4-(6,6-dimethylcyclohexen-1-yl)benzoic acid |
| SMILES | CC1(C)CCCC=C1c1ccc(C(=O)N2Cc3cccn3Cc3ccccc32)cc1.CC1(C)CCCC=C1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H28N2O.C15H18O2/c1-27(2)16-6-5-10-24(27)20-12-14-21(15-13-20)26(30)29-19-23-9-7-17-28(23)18-22-8-3-4-11-25(22)29;1-15(2)10-4-3-5-13(15)11-6-8-12(9-7-11)14(16)17/h3-4,7-15,17H,5-6,16,18-19H2,1-2H3;5-9H,3-4,10H2,1-2H3,(H,16,17) |
| InChIKey | VJFFPENDZDUGDQ-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.84 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |