About 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane
6-bromohex-1-ene;hex-5-enyl(dimethyl)silane (PubChem CID 161313835) has the molecular formula C14H29BrSi
and a molecular weight of 305.38 g/mol. Its IUPAC name is 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane.
Molecular Properties
| Compound Name | 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane |
| PubChem CID | 161313835 |
| Molecular Formula | C14H29BrSi |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane |
| SMILES | C=CCCCCBr.C=CCCCC[SiH](C)C |
| InChI | InChI=1S/C8H18Si.C6H11Br/c1-4-5-6-7-8-9(2)3;1-2-3-4-5-6-7/h4,9H,1,5-8H2,2-3H3;2H,1,3-6H2 |
| InChIKey | VJFWKUAAIFCRKI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane?
The IUPAC name of 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane (CID 161313835) is 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane.
What is the SMILES notation for 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane?
The canonical SMILES for 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane is C=CCCCCBr.C=CCCCC[SiH](C)C.
What is the InChIKey of 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane?
The InChIKey is VJFWKUAAIFCRKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18Si.C6H11Br/c1-4-5-6-7-8-9(2)3;1-2-3-4-5-6-7/h4,9H,1,5-8H2,2-3H3;2H,1,3-6H2.
What are the key properties of 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane?
6-bromohex-1-ene;hex-5-enyl(dimethyl)silane has a molecular weight of 305.38 g/mol, XLogP of 5.57, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromohex-1-ene;hex-5-enyl(dimethyl)silane is sourced from PubChem (CID 161313835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).