C7H16NO6P — CID 161313914
[(1,3-dihydroxy-2-methylpropan-2-yl)amino]oxy-[(2R,3S)-3-methyloxiran-2-yl]phosphinic acid (PubChem CID 161313914) has the molecular formula C7H16NO6P and a molecular weight of 241.18 g/mol. Its IUPAC name is [(1,3-dihydroxy-2-methylpropan-2-yl)amino]oxy-[(2R,3S)-3-methyloxiran-2-yl]phosphinic acid.
| Compound Name | [(1,3-dihydroxy-2-methylpropan-2-yl)amino]oxy-[(2R,3S)-3-methyloxiran-2-yl]phosphinic acid |
|---|---|
| PubChem CID | 161313914 |
| Molecular Formula | C7H16NO6P |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | [(1,3-dihydroxy-2-methylpropan-2-yl)amino]oxy-[(2R,3S)-3-methyloxiran-2-yl]phosphinic acid |
| SMILES | C[C@@H]1O[C@@H]1P(=O)(O)ONC(C)(CO)CO |
| InChI | InChI=1S/C7H16NO6P/c1-5-6(13-5)15(11,12)14-8-7(2,3-9)4-10/h5-6,8-10H,3-4H2,1-2H3,(H,11,12)/t5-,6+/m0/s1 |
| InChIKey | FMZJRULPSLJOMF-NTSWFWBYSA-N |
| XLogP | -0.82 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|