C12H10ClF3N3O4S+ — CID 161314117
3-[4-(4-chloro-1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 161314117) has the molecular formula C12H10ClF3N3O4S+ and a molecular weight of 384.74 g/mol. Its IUPAC name is 3-[4-(4-chloro-1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-(4-chloro-1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161314117 |
| Molecular Formula | C12H10ClF3N3O4S+ |
| Molecular Weight | 384.74 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 3-[4-(4-chloro-1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CC[n+]1ccc(-c2nc(Cl)cs2)cn1 |
| InChI | InChI=1S/C10H8ClN3O2S.C2HF3O2/c11-8-6-17-10(13-8)7-1-3-14(12-5-7)4-2-9(15)16;3-2(4,5)1(6)7/h1,3,5-6H,2,4H2;(H,6,7)/p+1 |
| InChIKey | YOTGKPSNKCTLRM-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.74 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|