C34H24BrF6N3O2 — CID 161314798
2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9H-fluoren-1-amine;4-(2-bromophenyl)-2-methylpyrimidine-5-carboxylic acid (PubChem CID 161314798) has the molecular formula C34H24BrF6N3O2 and a molecular weight of 700.48 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9H-fluoren-1-amine;4-(2-bromophenyl)-2-methylpyrimidine-5-carboxylic acid.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9H-fluoren-1-amine;4-(2-bromophenyl)-2-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 161314798 |
| Molecular Formula | C34H24BrF6N3O2 |
| Molecular Weight | 700.48 g/mol |
| Exact Mass | 699.10 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9H-fluoren-1-amine;4-(2-bromophenyl)-2-methylpyrimidine-5-carboxylic acid |
| SMILES | Cc1ncc(C(=O)O)c(-c2ccccc2Br)n1.Nc1c(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C22H15F6N.C12H9BrN2O2/c23-21(24,25)15-8-12(9-16(11-15)22(26,27)28)7-14-5-6-18-17-4-2-1-3-13(17)10-19(18)20(14)29;1-7-14-6-9(12(16)17)11(15-7)8-4-2-3-5-10(8)13/h1-6,8-9,11H,7,10,29H2;2-6H,1H3,(H,16,17) |
| InChIKey | VJIXKUMPNYBFIJ-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.48 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|