C17H22Y — CID 161316254
5,6-dimethylpentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-diene;yttrium (PubChem CID 161316254) has the molecular formula C17H22Y and a molecular weight of 315.27 g/mol. Its IUPAC name is 5,6-dimethylpentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-diene;yttrium.
| Compound Name | 5,6-dimethylpentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-diene;yttrium |
|---|---|
| PubChem CID | 161316254 |
| Molecular Formula | C17H22Y |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 5,6-dimethylpentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-diene;yttrium |
| SMILES | CC1=C(C)C2CC1C1CC3C4C=CC(C4)C3C21.[Y] |
| InChI | InChI=1S/C17H22.Y/c1-8-9(2)13-6-12(8)15-7-14-10-3-4-11(5-10)16(14)17(13)15;/h3-4,10-17H,5-7H2,1-2H3; |
| InChIKey | VJNORAVTRMAMDQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|