C22H33F3N2S — CID 161318052
1-methyl-N-[(E)-4-methylidene-8-[4-(trifluoromethylsulfanyl)cyclohexa-1,5-dien-1-yl]oct-2-en-2-yl]piperidin-4-amine (PubChem CID 161318052) has the molecular formula C22H33F3N2S and a molecular weight of 414.58 g/mol. Its IUPAC name is 1-methyl-N-[(E)-4-methylidene-8-[4-(trifluoromethylsulfanyl)cyclohexa-1,5-dien-1-yl]oct-2-en-2-yl]piperidin-4-amine.
| Compound Name | 1-methyl-N-[(E)-4-methylidene-8-[4-(trifluoromethylsulfanyl)cyclohexa-1,5-dien-1-yl]oct-2-en-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 161318052 |
| Molecular Formula | C22H33F3N2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-methyl-N-[(E)-4-methylidene-8-[4-(trifluoromethylsulfanyl)cyclohexa-1,5-dien-1-yl]oct-2-en-2-yl]piperidin-4-amine |
| SMILES | C=C(/C=C(\C)NC1CCN(C)CC1)CCCCC1=CCC(SC(F)(F)F)C=C1 |
| InChI | InChI=1S/C22H33F3N2S/c1-17(16-18(2)26-20-12-14-27(3)15-13-20)6-4-5-7-19-8-10-21(11-9-19)28-22(23,24)25/h8-10,16,20-21,26H,1,4-7,11-15H2,2-3H3/b18-16+ |
| InChIKey | VJTMUXCIUIBPAR-FBMGVBCBSA-N |
| XLogP | 6.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|