C43H50N6O9S2 — CID 161318080
1-ethyl-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-3-sulfonamide;1-ethyl-5-formyl-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-3-sulfonamide (PubChem CID 161318080) has the molecular formula C43H50N6O9S2 and a molecular weight of 859.04 g/mol. Its IUPAC name is 1-ethyl-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-3-sulfonamide;1-ethyl-5-formyl-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-3-sulfonamide.
| Compound Name | 1-ethyl-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-3-sulfonamide;1-ethyl-5-formyl-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 161318080 |
| Molecular Formula | C43H50N6O9S2 |
| Molecular Weight | 859.04 g/mol |
| Exact Mass | 858.31 |
| IUPAC Name | 1-ethyl-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-3-sulfonamide;1-ethyl-5-formyl-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-3-sulfonamide |
| SMILES | CCn1ccc(S(=O)(=O)N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)n1.CCn1nc(S(=O)(=O)N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)cc1C=O |
| InChI | InChI=1S/C22H25N3O5S.C21H25N3O4S/c1-4-25-19(16-26)13-22(23-25)31(27,28)24(14-17-5-9-20(29-2)10-6-17)15-18-7-11-21(30-3)12-8-18;1-4-23-14-13-21(22-23)29(25,26)24(15-17-5-9-19(27-2)10-6-17)16-18-7-11-20(28-3)12-8-18/h5-13,16H,4,14-15H2,1-3H3;5-14H,4,15-16H2,1-3H3 |
| InChIKey | VJTPBIPBOCVXSC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 164.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.04 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|