C23H35N6O5PS — CID 161318461
S-[2-[(benzylamino)-(propoxymethyl)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate;7H-purin-6-amine (PubChem CID 161318461) has the molecular formula C23H35N6O5PS and a molecular weight of 538.61 g/mol. Its IUPAC name is S-[2-[(benzylamino)-(propoxymethyl)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate;7H-purin-6-amine.
| Compound Name | S-[2-[(benzylamino)-(propoxymethyl)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate;7H-purin-6-amine |
|---|---|
| PubChem CID | 161318461 |
| Molecular Formula | C23H35N6O5PS |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | S-[2-[(benzylamino)-(propoxymethyl)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate;7H-purin-6-amine |
| SMILES | CCCOCP(=O)(NCc1ccccc1)OCCSC(=O)C(C)(C)CO.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C18H30NO5PS.C5H5N5/c1-4-10-23-15-25(22,19-13-16-8-6-5-7-9-16)24-11-12-26-17(21)18(2,3)14-20;6-4-3-5(9-1-7-3)10-2-8-4/h5-9,20H,4,10-15H2,1-3H3,(H,19,22);1-2H,(H3,6,7,8,9,10) |
| InChIKey | VJUSASYYFLUXOZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 165.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|