C15H18F17NO2S — CID 161319335
N-(4,4-dimethylpentyl)sulfamoyl fluoride;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-hexadecafluorooctane (PubChem CID 161319335) has the molecular formula C15H18F17NO2S and a molecular weight of 599.35 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)sulfamoyl fluoride;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-hexadecafluorooctane.
| Compound Name | N-(4,4-dimethylpentyl)sulfamoyl fluoride;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-hexadecafluorooctane |
|---|---|
| PubChem CID | 161319335 |
| Molecular Formula | C15H18F17NO2S |
| Molecular Weight | 599.35 g/mol |
| Exact Mass | 599.08 |
| IUPAC Name | N-(4,4-dimethylpentyl)sulfamoyl fluoride;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-hexadecafluorooctane |
| SMILES | CC(C)(C)CCCNS(=O)(=O)F.FCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F16.C7H16FNO2S/c9-1-2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24;1-7(2,3)5-4-6-9-12(8,10)11/h1H2;9H,4-6H2,1-3H3 |
| InChIKey | VJXUSWDJYMWEGZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.35 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|