C30H24F12N4O4 — CID 161319998
2-amino-4-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenol (PubChem CID 161319998) has the molecular formula C30H24F12N4O4 and a molecular weight of 732.52 g/mol. Its IUPAC name is 2-amino-4-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenol.
| Compound Name | 2-amino-4-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenol |
|---|---|
| PubChem CID | 161319998 |
| Molecular Formula | C30H24F12N4O4 |
| Molecular Weight | 732.52 g/mol |
| Exact Mass | 732.16 |
| IUPAC Name | 2-amino-4-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenol |
| SMILES | Nc1cc(C(c2ccc(O)c(N)c2)(C(F)(F)F)C(F)(F)F)ccc1O.Nc1cc(C(c2ccc(O)c(N)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/2C15H12F6N2O2/c2*16-14(17,18)13(15(19,20)21,7-1-3-11(24)9(22)5-7)8-2-4-12(25)10(23)6-8/h2*1-6,24-25H,22-23H2 |
| InChIKey | VJZZDVIQXIYEBX-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.52 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|