About CID 161320267
CID 161320267 (PubChem CID 161320267) has the molecular formula C17H22BNO6
and a molecular weight of 347.18 g/mol.
Molecular Properties
| Compound Name | CID 161320267 |
| PubChem CID | 161320267 |
| Molecular Formula | C17H22BNO6 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](OC(=O)COc2ccc(OCC(=O)NC)cc2)[C@@H](CC)O1 |
| InChI | InChI=1S/C17H22BNO6/c1-3-13-14(8-15(18)24-13)25-17(21)10-23-12-6-4-11(5-7-12)22-9-16(20)19-2/h4-7,13-15H,3,8-10H2,1-2H3,(H,19,20)/t13-,14-,15-/m1/s1 |
| InChIKey | DCCXPWTWHRYOQH-RBSFLKMASA-N |
| XLogP | 0.80 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 161320267 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161320267?
The IUPAC name of CID 161320267 (CID 161320267) is not available.
What is the SMILES notation for CID 161320267?
The canonical SMILES for CID 161320267 is [B][C@H]1C[C@@H](OC(=O)COc2ccc(OCC(=O)NC)cc2)[C@@H](CC)O1.
What is the InChIKey of CID 161320267?
The InChIKey is DCCXPWTWHRYOQH-RBSFLKMASA-N. The full InChI is InChI=1S/C17H22BNO6/c1-3-13-14(8-15(18)24-13)25-17(21)10-23-12-6-4-11(5-7-12)22-9-16(20)19-2/h4-7,13-15H,3,8-10H2,1-2H3,(H,19,20)/t13-,14-,15-/m1/s1.
What are the key properties of CID 161320267?
CID 161320267 has a molecular weight of 347.18 g/mol, XLogP of 0.80, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161320267 is sourced from PubChem (CID 161320267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).