About methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole
methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole (PubChem CID 161320602) has the molecular formula C14H25N3O3S
and a molecular weight of 315.44 g/mol. Its IUPAC name is methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole.
Molecular Properties
| Compound Name | methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole |
| PubChem CID | 161320602 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole |
| SMILES | C.COC1CCCCC1N1Cc2cn(S(C)(=O)=O)nc2C1 |
| InChI | InChI=1S/C13H21N3O3S.CH4/c1-19-13-6-4-3-5-12(13)15-7-10-8-16(20(2,17)18)14-11(10)9-15;/h8,12-13H,3-7,9H2,1-2H3;1H4 |
| InChIKey | VKBYOOHOFNHMDC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole?
The IUPAC name of methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole (CID 161320602) is methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole.
What is the SMILES notation for methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole?
The canonical SMILES for methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole is C.COC1CCCCC1N1Cc2cn(S(C)(=O)=O)nc2C1.
What is the InChIKey of methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole?
The InChIKey is VKBYOOHOFNHMDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3S.CH4/c1-19-13-6-4-3-5-12(13)15-7-10-8-16(20(2,17)18)14-11(10)9-15;/h8,12-13H,3-7,9H2,1-2H3;1H4.
What are the key properties of methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole?
methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole has a molecular weight of 315.44 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-(2-methoxycyclohexyl)-2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazole is sourced from PubChem (CID 161320602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).