C50H41F2N3O3 — CID 161324923
4-[bis(4-aminophenyl)-(4-fluorophenyl)methyl]aniline;4-[(4-fluorophenyl)-bis(4-hydroxyphenyl)methyl]phenol (PubChem CID 161324923) has the molecular formula C50H41F2N3O3 and a molecular weight of 769.89 g/mol. Its IUPAC name is 4-[bis(4-aminophenyl)-(4-fluorophenyl)methyl]aniline;4-[(4-fluorophenyl)-bis(4-hydroxyphenyl)methyl]phenol.
| Compound Name | 4-[bis(4-aminophenyl)-(4-fluorophenyl)methyl]aniline;4-[(4-fluorophenyl)-bis(4-hydroxyphenyl)methyl]phenol |
|---|---|
| PubChem CID | 161324923 |
| Molecular Formula | C50H41F2N3O3 |
| Molecular Weight | 769.89 g/mol |
| Exact Mass | 769.31 |
| IUPAC Name | 4-[bis(4-aminophenyl)-(4-fluorophenyl)methyl]aniline;4-[(4-fluorophenyl)-bis(4-hydroxyphenyl)methyl]phenol |
| SMILES | Nc1ccc(C(c2ccc(N)cc2)(c2ccc(N)cc2)c2ccc(F)cc2)cc1.Oc1ccc(C(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H22FN3.C25H19FO3/c2*26-21-9-1-17(2-10-21)25(18-3-11-22(27)12-4-18,19-5-13-23(28)14-6-19)20-7-15-24(29)16-8-20/h1-16H,27-29H2;1-16,27-29H |
| InChIKey | VKQIMACCQRSJFM-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.89 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|