C46H40BBr3N2O4 — CID 161325621
1-[3-(3-bromophenyl)carbazol-9-yl]ethanone;1,3-dibromobenzene;1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]ethanone (PubChem CID 161325621) has the molecular formula C46H40BBr3N2O4 and a molecular weight of 935.36 g/mol. Its IUPAC name is 1-[3-(3-bromophenyl)carbazol-9-yl]ethanone;1,3-dibromobenzene;1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]ethanone.
| Compound Name | 1-[3-(3-bromophenyl)carbazol-9-yl]ethanone;1,3-dibromobenzene;1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]ethanone |
|---|---|
| PubChem CID | 161325621 |
| Molecular Formula | C46H40BBr3N2O4 |
| Molecular Weight | 935.36 g/mol |
| Exact Mass | 932.06 |
| IUPAC Name | 1-[3-(3-bromophenyl)carbazol-9-yl]ethanone;1,3-dibromobenzene;1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]ethanone |
| SMILES | Brc1cccc(Br)c1.CC(=O)n1c2ccccc2c2cc(-c3cccc(Br)c3)ccc21.CC(=O)n1c2ccccc2c2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C20H22BNO3.C20H14BrNO.C6H4Br2/c1-13(23)22-17-9-7-6-8-15(17)16-12-14(10-11-18(16)22)21-24-19(2,3)20(4,5)25-21;1-13(23)22-19-8-3-2-7-17(19)18-12-15(9-10-20(18)22)14-5-4-6-16(21)11-14;7-5-2-1-3-6(8)4-5/h6-12H,1-5H3;2-12H,1H3;1-4H |
| InChIKey | VKSNQCNSIOFTAB-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.36 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|