C23H20F2O5 — CID 161326312
2-(3-fluorophenyl)acetic acid;2-(3-fluorophenyl)-1-(2-hydroxy-4-methoxyphenyl)ethanone (PubChem CID 161326312) has the molecular formula C23H20F2O5 and a molecular weight of 414.40 g/mol. Its IUPAC name is 2-(3-fluorophenyl)acetic acid;2-(3-fluorophenyl)-1-(2-hydroxy-4-methoxyphenyl)ethanone.
| Compound Name | 2-(3-fluorophenyl)acetic acid;2-(3-fluorophenyl)-1-(2-hydroxy-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 161326312 |
| Molecular Formula | C23H20F2O5 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-(3-fluorophenyl)acetic acid;2-(3-fluorophenyl)-1-(2-hydroxy-4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2cccc(F)c2)c(O)c1.O=C(O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H13FO3.C8H7FO2/c1-19-12-5-6-13(15(18)9-12)14(17)8-10-3-2-4-11(16)7-10;9-7-3-1-2-6(4-7)5-8(10)11/h2-7,9,18H,8H2,1H3;1-4H,5H2,(H,10,11) |
| InChIKey | VKUVTILTDGBTMT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |