C26H14F9NO3P- — CID 161327250
2-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)-4-(trifluoromethyl)phenol hexafluorophosphate (PubChem CID 161327250) has the molecular formula C26H14F9NO3P- and a molecular weight of 590.36 g/mol. Its IUPAC name is 2-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)-4-(trifluoromethyl)phenol hexafluorophosphate.
| Compound Name | 2-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)-4-(trifluoromethyl)phenol hexafluorophosphate |
|---|---|
| PubChem CID | 161327250 |
| Molecular Formula | C26H14F9NO3P- |
| Molecular Weight | 590.36 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | 2-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)-4-(trifluoromethyl)phenol hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.Oc1ccc(C(F)(F)F)cc1N1c2cccc3c2C2c4c(cccc4Oc4cccc1c42)O3 |
| InChI | InChI=1S/C26H14F3NO3.F6P/c27-26(28,29)13-10-11-17(31)16(12-13)30-14-4-1-6-18-22(14)25-23-15(30)5-2-7-19(23)33-21-9-3-8-20(32-18)24(21)25;1-7(2,3,4,5)6/h1-12,25,31H;/q;-1 |
| InChIKey | JOVOLLMSVCANBP-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.36 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|