C26H35BN2O4 — CID 161328091
[(4R,7S)-7-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-2-methyl-6-oxo-9-phenylnonan-4-yl]boronic acid (PubChem CID 161328091) has the molecular formula C26H35BN2O4 and a molecular weight of 450.39 g/mol. Its IUPAC name is [(4R,7S)-7-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-2-methyl-6-oxo-9-phenylnonan-4-yl]boronic acid.
| Compound Name | [(4R,7S)-7-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-2-methyl-6-oxo-9-phenylnonan-4-yl]boronic acid |
|---|---|
| PubChem CID | 161328091 |
| Molecular Formula | C26H35BN2O4 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | [(4R,7S)-7-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-2-methyl-6-oxo-9-phenylnonan-4-yl]boronic acid |
| SMILES | CC(C)C[C@H](CC(=O)[C@H](CCc1ccccc1)NC(=O)N1CCc2ccccc2C1)B(O)O |
| InChI | InChI=1S/C26H35BN2O4/c1-19(2)16-23(27(32)33)17-25(30)24(13-12-20-8-4-3-5-9-20)28-26(31)29-15-14-21-10-6-7-11-22(21)18-29/h3-11,19,23-24,32-33H,12-18H2,1-2H3,(H,28,31)/t23-,24+/m1/s1 |
| InChIKey | VLAVBROSOREUEQ-RPWUZVMVSA-N |
| XLogP | 3.60 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|