C48H50N6O3 — CID 161328207
4-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-one;3-[1-(1,4-dioxaspiro[4.5]decan-8-yl)-5-isocyano-6-methylindol-3-yl]-2-methylaniline (PubChem CID 161328207) has the molecular formula C48H50N6O3 and a molecular weight of 758.97 g/mol. Its IUPAC name is 4-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-one;3-[1-(1,4-dioxaspiro[4.5]decan-8-yl)-5-isocyano-6-methylindol-3-yl]-2-methylaniline.
| Compound Name | 4-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-one;3-[1-(1,4-dioxaspiro[4.5]decan-8-yl)-5-isocyano-6-methylindol-3-yl]-2-methylaniline |
|---|---|
| PubChem CID | 161328207 |
| Molecular Formula | C48H50N6O3 |
| Molecular Weight | 758.97 g/mol |
| Exact Mass | 758.39 |
| IUPAC Name | 4-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-one;3-[1-(1,4-dioxaspiro[4.5]decan-8-yl)-5-isocyano-6-methylindol-3-yl]-2-methylaniline |
| SMILES | [C-]#[N+]c1cc2c(-c3cccc(N)c3C)cn(C3CCC(=O)CC3)c2cc1C.[C-]#[N+]c1cc2c(-c3cccc(N)c3C)cn(C3CCC4(CC3)OCCO4)c2cc1C |
| InChI | InChI=1S/C25H27N3O2.C23H23N3O/c1-16-13-24-20(14-23(16)27-3)21(19-5-4-6-22(26)17(19)2)15-28(24)18-7-9-25(10-8-18)29-11-12-30-25;1-14-11-23-19(12-22(14)25-3)20(18-5-4-6-21(24)15(18)2)13-26(23)16-7-9-17(27)10-8-16/h4-6,13-15,18H,7-12,26H2,1-2H3;4-6,11-13,16H,7-10,24H2,1-2H3 |
| InChIKey | VLBFLIHXIDCHBE-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.97 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|