C19H30N12O2 — CID 161329317
3-tert-butyl-6,8-dihydro-5H-imidazo[4,5-d]diazepine-4,7-dione;(9-tert-butyl-2-hydrazinylpurin-6-yl)hydrazine (PubChem CID 161329317) has the molecular formula C19H30N12O2 and a molecular weight of 458.53 g/mol. Its IUPAC name is 3-tert-butyl-6,8-dihydro-5H-imidazo[4,5-d]diazepine-4,7-dione;(9-tert-butyl-2-hydrazinylpurin-6-yl)hydrazine.
| Compound Name | 3-tert-butyl-6,8-dihydro-5H-imidazo[4,5-d]diazepine-4,7-dione;(9-tert-butyl-2-hydrazinylpurin-6-yl)hydrazine |
|---|---|
| PubChem CID | 161329317 |
| Molecular Formula | C19H30N12O2 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 3-tert-butyl-6,8-dihydro-5H-imidazo[4,5-d]diazepine-4,7-dione;(9-tert-butyl-2-hydrazinylpurin-6-yl)hydrazine |
| SMILES | CC(C)(C)n1cnc2c(NN)nc(NN)nc21.CC(C)(C)n1cnc2c1C(=O)NNC(=O)C2 |
| InChI | InChI=1S/C10H14N4O2.C9H16N8/c1-10(2,3)14-5-11-6-4-7(15)12-13-9(16)8(6)14;1-9(2,3)17-4-12-5-6(15-10)13-8(16-11)14-7(5)17/h5H,4H2,1-3H3,(H,12,15)(H,13,16);4H,10-11H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | VLEXXZSZCFZGBS-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 195.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|