C19H27Cl3SiTi — CID 161329747
[1-(cyclohexylmethyl)cyclohexa-2,4-dien-1-yl]-(3-methylcyclopenta-2,4-dien-1-yl)silane;titanium(4+);trichloride (PubChem CID 161329747) has the molecular formula C19H27Cl3SiTi and a molecular weight of 437.74 g/mol. Its IUPAC name is [1-(cyclohexylmethyl)cyclohexa-2,4-dien-1-yl]-(3-methylcyclopenta-2,4-dien-1-yl)silane;titanium(4+);trichloride.
| Compound Name | [1-(cyclohexylmethyl)cyclohexa-2,4-dien-1-yl]-(3-methylcyclopenta-2,4-dien-1-yl)silane;titanium(4+);trichloride |
|---|---|
| PubChem CID | 161329747 |
| Molecular Formula | C19H27Cl3SiTi |
| Molecular Weight | 437.74 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | [1-(cyclohexylmethyl)cyclohexa-2,4-dien-1-yl]-(3-methylcyclopenta-2,4-dien-1-yl)silane;titanium(4+);trichloride |
| SMILES | Cc1cc[c-]([SiH2]C2(CC3CCCCC3)C=CC=CC2)c1.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C19H27Si.3ClH.Ti/c1-16-10-11-18(14-16)20-19(12-6-3-7-13-19)15-17-8-4-2-5-9-17;;;;/h3,6-7,10-12,14,17H,2,4-5,8-9,13,15,20H2,1H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | RCOSDVJCORVOLB-UHFFFAOYSA-K |
| XLogP | -4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.74 |
| LogP ≤ 5 | -4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|