C18H24N2O14Pt3 — CID 161329805
cyclohexane-1,2-diamine;bis(1-hydroxypropane-1,2,3-tricarboxylate);tris(platinum(2+)) (PubChem CID 161329805) has the molecular formula C18H24N2O14Pt3 and a molecular weight of 1077.62 g/mol. Its IUPAC name is cyclohexane-1,2-diamine;bis(1-hydroxypropane-1,2,3-tricarboxylate);tris(platinum(2+)).
| Compound Name | cyclohexane-1,2-diamine;bis(1-hydroxypropane-1,2,3-tricarboxylate);tris(platinum(2+)) |
|---|---|
| PubChem CID | 161329805 |
| Molecular Formula | C18H24N2O14Pt3 |
| Molecular Weight | 1077.62 g/mol |
| Exact Mass | 1077.02 |
| IUPAC Name | cyclohexane-1,2-diamine;bis(1-hydroxypropane-1,2,3-tricarboxylate);tris(platinum(2+)) |
| SMILES | NC1CCCCC1N.O=C([O-])CC(C(=O)[O-])C(O)C(=O)[O-].O=C([O-])CC(C(=O)[O-])C(O)C(=O)[O-].[Pt+2].[Pt+2].[Pt+2] |
| InChI | InChI=1S/C6H14N2.2C6H8O7.3Pt/c7-5-3-1-2-4-6(5)8;2*7-3(8)1-2(5(10)11)4(9)6(12)13;;;/h5-6H,1-4,7-8H2;2*2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13);;;/q;;;3*+2/p-6 |
| InChIKey | VLGPHCNUWQOIEZ-UHFFFAOYSA-H |
| XLogP | -10.59 |
| TPSA | 333.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1077.62 |
| LogP ≤ 5 | -10.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |