C34H39N3O4 — CID 161330187
2-(benzylideneamino)-4-tert-butylphenol;4-tert-butyl-2-[(3-nitrophenyl)methylamino]phenol (PubChem CID 161330187) has the molecular formula C34H39N3O4 and a molecular weight of 553.70 g/mol. Its IUPAC name is 2-(benzylideneamino)-4-tert-butylphenol;4-tert-butyl-2-[(3-nitrophenyl)methylamino]phenol.
| Compound Name | 2-(benzylideneamino)-4-tert-butylphenol;4-tert-butyl-2-[(3-nitrophenyl)methylamino]phenol |
|---|---|
| PubChem CID | 161330187 |
| Molecular Formula | C34H39N3O4 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | 2-(benzylideneamino)-4-tert-butylphenol;4-tert-butyl-2-[(3-nitrophenyl)methylamino]phenol |
| SMILES | CC(C)(C)c1ccc(O)c(/N=C/c2ccccc2)c1.CC(C)(C)c1ccc(O)c(NCc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C17H20N2O3.C17H19NO/c1-17(2,3)13-7-8-16(20)15(10-13)18-11-12-5-4-6-14(9-12)19(21)22;1-17(2,3)14-9-10-16(19)15(11-14)18-12-13-7-5-4-6-8-13/h4-10,18,20H,11H2,1-3H3;4-12,19H,1-3H3/b;18-12+ |
| InChIKey | VLHSUSISUGFJRZ-RAACJHSHSA-N |
| XLogP | 8.65 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|