About 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane
1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane (PubChem CID 161330228) has the molecular formula C8H12Cl2O2S4
and a molecular weight of 339.36 g/mol. Its IUPAC name is 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane.
Molecular Properties
| Compound Name | 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane |
| PubChem CID | 161330228 |
| Molecular Formula | C8H12Cl2O2S4 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 337.91 |
| IUPAC Name | 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane |
| SMILES | C1SS1.O=C(CCl)CCl.O=C1CSCSC1 |
| InChI | InChI=1S/C4H6OS2.C3H4Cl2O.CH2S2/c5-4-1-6-3-7-2-4;4-1-3(6)2-5;1-2-3-1/h1-3H2;1-2H2;1H2 |
| InChIKey | VLHXWKFSUNGKDA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane?
The IUPAC name of 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane (CID 161330228) is 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane.
What is the SMILES notation for 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane?
The canonical SMILES for 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane is C1SS1.O=C(CCl)CCl.O=C1CSCSC1.
What is the InChIKey of 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane?
The InChIKey is VLHXWKFSUNGKDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6OS2.C3H4Cl2O.CH2S2/c5-4-1-6-3-7-2-4;4-1-3(6)2-5;1-2-3-1/h1-3H2;1-2H2;1H2.
What are the key properties of 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane?
1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane has a molecular weight of 339.36 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloropropan-2-one;1,3-dithian-5-one;dithiirane is sourced from PubChem (CID 161330228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).