C62H90GaN15O20S — CID 161330467
CID 161330467 (PubChem CID 161330467) has the molecular formula C62H90GaN15O20S and a molecular weight of 1465.48 g/mol.
| Compound Name | CID 161330467 |
|---|---|
| PubChem CID | 161330467 |
| Molecular Formula | C62H90GaN15O20S |
| Molecular Weight | 1465.48 g/mol |
| Exact Mass | 1464.55 |
| IUPAC Name | — |
| SMILES | Cc1nnc(NC(=O)CCCc2cn(CCCC[C@H](NC(=O)C[C@H](NC(=O)C[C@H](NC(=O)CCC(C)(c3ccc(O)cc3)c3ccc(O)cc3)C(=O)O)C(=O)O)C(=O)NCCOCCOCCNC(=O)CN3CCN(COC=O)CCN(COC=O)CCN(CC(O)O[68Ga])CC3)nn2)s1 |
| InChI | InChI=1S/C62H90N15O20S.Ga/c1-43-69-71-61(98-43)68-52(82)8-5-6-46-36-77(72-70-46)21-4-3-7-49(65-54(84)35-51(60(92)93)67-55(85)34-50(59(90)91)66-53(83)17-18-62(2,44-9-13-47(80)14-10-44)45-11-15-48(81)16-12-45)58(89)64-20-31-95-33-32-94-30-19-63-56(86)37-73-22-23-74(38-57(87)88)25-27-76(40-97-42-79)29-28-75(26-24-73)39-96-41-78;/h9-16,36,41-42,49-51,57,80-81,87H,3-8,17-35,37-40H2,1-2H3,(H,63,86)(H,64,89)(H,65,84)(H,66,83)(H,67,85)(H,90,91)(H,92,93)(H,68,71,82);/q-1;+1/t49-,50-,51-,57?;/m0./s1/i;1-2 |
| InChIKey | OYMHVCZZJIUTMH-BDROXAMLSA-N |
| XLogP | -1.66 |
| TPSA | 459.63 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 99 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1465.48 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|