C34H48Br2N4OSi — CID 161330631
5-bromo-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole;2-[[5-bromo-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 161330631) has the molecular formula C34H48Br2N4OSi and a molecular weight of 716.68 g/mol. Its IUPAC name is 5-bromo-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole;2-[[5-bromo-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 5-bromo-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole;2-[[5-bromo-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 161330631 |
| Molecular Formula | C34H48Br2N4OSi |
| Molecular Weight | 716.68 g/mol |
| Exact Mass | 714.20 |
| IUPAC Name | 5-bromo-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole;2-[[5-bromo-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CN1CCC[C@@H]1Cc1c[nH]c2ccc(Br)cc12.CN1CCC[C@@H]1Cc1cn(COCC[Si](C)(C)C)c2ccc(Br)cc12 |
| InChI | InChI=1S/C20H31BrN2OSi.C14H17BrN2/c1-22-9-5-6-18(22)12-16-14-23(15-24-10-11-25(2,3)4)20-8-7-17(21)13-19(16)20;1-17-6-2-3-12(17)7-10-9-16-14-5-4-11(15)8-13(10)14/h7-8,13-14,18H,5-6,9-12,15H2,1-4H3;4-5,8-9,12,16H,2-3,6-7H2,1H3/t18-;12-/m11/s1 |
| InChIKey | VLJFESNXCDOUCP-WQKYGFMSSA-N |
| XLogP | 8.92 |
| TPSA | 36.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.68 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|