C24H20ClN3O4S — CID 161331973
3-[7-[(2R)-5-chloro-2-(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-yl)-2,3-dihydro-1-benzofuran-7-yl]thieno[3,2-b]pyridin-2-yl]oxetan-3-ol (PubChem CID 161331973) has the molecular formula C24H20ClN3O4S and a molecular weight of 481.96 g/mol. Its IUPAC name is 3-[7-[(2R)-5-chloro-2-(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-yl)-2,3-dihydro-1-benzofuran-7-yl]thieno[3,2-b]pyridin-2-yl]oxetan-3-ol.
| Compound Name | 3-[7-[(2R)-5-chloro-2-(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-yl)-2,3-dihydro-1-benzofuran-7-yl]thieno[3,2-b]pyridin-2-yl]oxetan-3-ol |
|---|---|
| PubChem CID | 161331973 |
| Molecular Formula | C24H20ClN3O4S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 3-[7-[(2R)-5-chloro-2-(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-yl)-2,3-dihydro-1-benzofuran-7-yl]thieno[3,2-b]pyridin-2-yl]oxetan-3-ol |
| SMILES | OC1(c2cc3nccc(-c4cc(Cl)cc5c4O[C@@H](c4onc6c4CNCC6)C5)c3s2)COC1 |
| InChI | InChI=1S/C24H20ClN3O4S/c25-13-5-12-6-19(22-16-9-26-3-2-17(16)28-32-22)31-21(12)15(7-13)14-1-4-27-18-8-20(33-23(14)18)24(29)10-30-11-24/h1,4-5,7-8,19,26,29H,2-3,6,9-11H2/t19-/m1/s1 |
| InChIKey | VLNOEPLSLCIBKI-LJQANCHMSA-N |
| XLogP | 4.14 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |