About 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol
1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol (PubChem CID 161332440) has the molecular formula C22H27Br3O2
and a molecular weight of 563.17 g/mol. Its IUPAC name is 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol.
Molecular Properties
| Compound Name | 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol |
| PubChem CID | 161332440 |
| Molecular Formula | C22H27Br3O2 |
| Molecular Weight | 563.17 g/mol |
| Exact Mass | 559.96 |
| IUPAC Name | 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol |
| SMILES | BrCC1CCC1.Brc1ccc(OCC2CCC2)cc1.Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H13BrO.C6H5BrO.C5H9Br/c12-10-4-6-11(7-5-10)13-8-9-2-1-3-9;7-5-1-3-6(8)4-2-5;6-4-5-2-1-3-5/h4-7,9H,1-3,8H2;1-4,8H;5H,1-4H2 |
| InChIKey | VLPHHMWIVMOVKN-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.17 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol?
The IUPAC name of 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol (CID 161332440) is 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol.
What is the SMILES notation for 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol?
The canonical SMILES for 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol is BrCC1CCC1.Brc1ccc(OCC2CCC2)cc1.Oc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol?
The InChIKey is VLPHHMWIVMOVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO.C6H5BrO.C5H9Br/c12-10-4-6-11(7-5-10)13-8-9-2-1-3-9;7-5-1-3-6(8)4-2-5;6-4-5-2-1-3-5/h4-7,9H,1-3,8H2;1-4,8H;5H,1-4H2.
What are the key properties of 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol?
1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol has a molecular weight of 563.17 g/mol, XLogP of 7.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(cyclobutylmethoxy)benzene;bromomethylcyclobutane;4-bromophenol is sourced from PubChem (CID 161332440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).