About imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane
imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane (PubChem CID 161332571) has the molecular formula C5H17NO3S2
and a molecular weight of 203.33 g/mol. Its IUPAC name is imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane.
Molecular Properties
| Compound Name | imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane |
| PubChem CID | 161332571 |
| Molecular Formula | C5H17NO3S2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane |
| SMILES | CO.CS(C)=O.[H]N=S(C)(C)=O |
| InChI | InChI=1S/C2H7NOS.C2H6OS.CH4O/c1-5(2,3)4;1-4(2)3;1-2/h3H,1-2H3;1-2H3;2H,1H3 |
| InChIKey | VLPREYPLQRIGED-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane?
The IUPAC name of imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane (CID 161332571) is imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane.
What is the SMILES notation for imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane?
The canonical SMILES for imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane is CO.CS(C)=O.[H]N=S(C)(C)=O.
What is the InChIKey of imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane?
The InChIKey is VLPREYPLQRIGED-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NOS.C2H6OS.CH4O/c1-5(2,3)4;1-4(2)3;1-2/h3H,1-2H3;1-2H3;2H,1H3.
What are the key properties of imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane?
imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane has a molecular weight of 203.33 g/mol, XLogP of -0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imino-dimethyl-oxo-λ6-sulfane;methanol;methylsulfinylmethane is sourced from PubChem (CID 161332571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).