About dimethoxysilane;2,5-dimethylsilolane
dimethoxysilane;2,5-dimethylsilolane (PubChem CID 161332603) has the molecular formula C8H22O2Si2
and a molecular weight of 206.43 g/mol. Its IUPAC name is dimethoxysilane;2,5-dimethylsilolane.
Molecular Properties
| Compound Name | dimethoxysilane;2,5-dimethylsilolane |
| PubChem CID | 161332603 |
| Molecular Formula | C8H22O2Si2 |
| Molecular Weight | 206.43 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | dimethoxysilane;2,5-dimethylsilolane |
| SMILES | CC1CCC(C)[SiH2]1.CO[SiH2]OC |
| InChI | InChI=1S/C6H14Si.C2H8O2Si/c1-5-3-4-6(2)7-5;1-3-5-4-2/h5-6H,3-4,7H2,1-2H3;5H2,1-2H3 |
| InChIKey | VLPSZDDQQYLQLX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxysilane;2,5-dimethylsilolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxysilane;2,5-dimethylsilolane?
The IUPAC name of dimethoxysilane;2,5-dimethylsilolane (CID 161332603) is dimethoxysilane;2,5-dimethylsilolane.
What is the SMILES notation for dimethoxysilane;2,5-dimethylsilolane?
The canonical SMILES for dimethoxysilane;2,5-dimethylsilolane is CC1CCC(C)[SiH2]1.CO[SiH2]OC.
What is the InChIKey of dimethoxysilane;2,5-dimethylsilolane?
The InChIKey is VLPSZDDQQYLQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14Si.C2H8O2Si/c1-5-3-4-6(2)7-5;1-3-5-4-2/h5-6H,3-4,7H2,1-2H3;5H2,1-2H3.
What are the key properties of dimethoxysilane;2,5-dimethylsilolane?
dimethoxysilane;2,5-dimethylsilolane has a molecular weight of 206.43 g/mol, XLogP of 0.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxysilane;2,5-dimethylsilolane is sourced from PubChem (CID 161332603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).