C26H47BrN10O6 — CID 161332844
(5R)-5-(azidomethyl)pyrrolidin-2-one;tert-butyl N-[3-[(2R)-2-(azidomethyl)-5-oxopyrrolidin-1-yl]propyl]carbamate;tert-butyl N-(3-bromopropyl)carbamate (PubChem CID 161332844) has the molecular formula C26H47BrN10O6 and a molecular weight of 675.63 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)pyrrolidin-2-one;tert-butyl N-[3-[(2R)-2-(azidomethyl)-5-oxopyrrolidin-1-yl]propyl]carbamate;tert-butyl N-(3-bromopropyl)carbamate.
| Compound Name | (5R)-5-(azidomethyl)pyrrolidin-2-one;tert-butyl N-[3-[(2R)-2-(azidomethyl)-5-oxopyrrolidin-1-yl]propyl]carbamate;tert-butyl N-(3-bromopropyl)carbamate |
|---|---|
| PubChem CID | 161332844 |
| Molecular Formula | C26H47BrN10O6 |
| Molecular Weight | 675.63 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | (5R)-5-(azidomethyl)pyrrolidin-2-one;tert-butyl N-[3-[(2R)-2-(azidomethyl)-5-oxopyrrolidin-1-yl]propyl]carbamate;tert-butyl N-(3-bromopropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCBr.CC(C)(C)OC(=O)NCCCN1C(=O)CC[C@@H]1CN=[N+]=[N-].[N-]=[N+]=NC[C@H]1CCC(=O)N1 |
| InChI | InChI=1S/C13H23N5O3.C8H16BrNO2.C5H8N4O/c1-13(2,3)21-12(20)15-7-4-8-18-10(9-16-17-14)5-6-11(18)19;1-8(2,3)12-7(11)10-6-4-5-9;6-9-7-3-4-1-2-5(10)8-4/h10H,4-9H2,1-3H3,(H,15,20);4-6H2,1-3H3,(H,10,11);4H,1-3H2,(H,8,10)/t10-;;4-/m1.1/s1 |
| InChIKey | VLQMLPKADISQHZ-COCFJCCCSA-N |
| XLogP | 5.07 |
| TPSA | 223.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|