C24H29FN6S — CID 161336104
(3aS,6aS)-1-(4-fluorophenyl)-5-[3-[[4-methyl-5-(6-methylidene-3-pyridinylidene)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 161336104) has the molecular formula C24H29FN6S and a molecular weight of 452.60 g/mol. Its IUPAC name is (3aS,6aS)-1-(4-fluorophenyl)-5-[3-[[4-methyl-5-(6-methylidene-3-pyridinylidene)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-1-(4-fluorophenyl)-5-[3-[[4-methyl-5-(6-methylidene-3-pyridinylidene)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 161336104 |
| Molecular Formula | C24H29FN6S |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (3aS,6aS)-1-(4-fluorophenyl)-5-[3-[[4-methyl-5-(6-methylidene-3-pyridinylidene)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | C=c1ccc(=C2NN=C(SCCCN3C[C@@H]4CCN(c5ccc(F)cc5)[C@@H]4C3)N2C)cn1 |
| InChI | InChI=1S/C24H29FN6S/c1-17-4-5-18(14-26-17)23-27-28-24(29(23)2)32-13-3-11-30-15-19-10-12-31(22(19)16-30)21-8-6-20(25)7-9-21/h4-9,14,19,22,27H,1,3,10-13,15-16H2,2H3/t19-,22+/m0/s1 |
| InChIKey | UEYHYOUPOLEGBQ-SIKLNZKXSA-N |
| XLogP | 1.84 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|