C8H6F6N2O — CID 161336407
4,5-bis(2,2,2-trifluoroethyl)-1H-pyridazin-6-one (PubChem CID 161336407) has the molecular formula C8H6F6N2O and a molecular weight of 260.14 g/mol. Its IUPAC name is 4,5-bis(2,2,2-trifluoroethyl)-1H-pyridazin-6-one.
| Compound Name | 4,5-bis(2,2,2-trifluoroethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 161336407 |
| Molecular Formula | C8H6F6N2O |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4,5-bis(2,2,2-trifluoroethyl)-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(CC(F)(F)F)c1CC(F)(F)F |
| InChI | InChI=1S/C8H6F6N2O/c9-7(10,11)1-4-3-15-16-6(17)5(4)2-8(12,13)14/h3H,1-2H2,(H,16,17) |
| InChIKey | VMCAYPFZVNEZHX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |