About 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide
2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide (PubChem CID 161338568) has the molecular formula C19H29ClN2O2
and a molecular weight of 352.91 g/mol. Its IUPAC name is 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide.
Molecular Properties
| Compound Name | 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide |
| PubChem CID | 161338568 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide |
| SMILES | CC(c1ccccc1Cl)N1CCC(O)(C(C)(C)C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C19H29ClN2O2/c1-14(15-8-6-7-9-16(15)20)22-12-10-19(24,11-13-22)18(2,3)17(23)21(4)5/h6-9,14,24H,10-13H2,1-5H3 |
| InChIKey | VMJDUKOUKQRIDS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide?
The IUPAC name of 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide (CID 161338568) is 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide.
What is the SMILES notation for 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide?
The canonical SMILES for 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide is CC(c1ccccc1Cl)N1CCC(O)(C(C)(C)C(=O)N(C)C)CC1.
What is the InChIKey of 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide?
The InChIKey is VMJDUKOUKQRIDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29ClN2O2/c1-14(15-8-6-7-9-16(15)20)22-12-10-19(24,11-13-22)18(2,3)17(23)21(4)5/h6-9,14,24H,10-13H2,1-5H3.
What are the key properties of 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide?
2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide has a molecular weight of 352.91 g/mol, XLogP of 3.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[1-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N,N,2-trimethylpropanamide is sourced from PubChem (CID 161338568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).