About 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline
4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline (PubChem CID 161339651) has the molecular formula C14H14Br2IN
and a molecular weight of 482.99 g/mol. Its IUPAC name is 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline.
Molecular Properties
| Compound Name | 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline |
| PubChem CID | 161339651 |
| Molecular Formula | C14H14Br2IN |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 480.85 |
| IUPAC Name | 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline |
| SMILES | Cc1ccc(Br)cc1I.Cc1ccc(Br)cc1N |
| InChI | InChI=1S/C7H6BrI.C7H8BrN/c2*1-5-2-3-6(8)4-7(5)9/h2-4H,1H3;2-4H,9H2,1H3 |
| InChIKey | VMMPAZVDEQLHKA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline?
The IUPAC name of 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline (CID 161339651) is 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline.
What is the SMILES notation for 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline?
The canonical SMILES for 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline is Cc1ccc(Br)cc1I.Cc1ccc(Br)cc1N.
What is the InChIKey of 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline?
The InChIKey is VMMPAZVDEQLHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrI.C7H8BrN/c2*1-5-2-3-6(8)4-7(5)9/h2-4H,1H3;2-4H,9H2,1H3.
What are the key properties of 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline?
4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline has a molecular weight of 482.99 g/mol, XLogP of 5.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-iodo-1-methylbenzene;5-bromo-2-methylaniline is sourced from PubChem (CID 161339651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).