C5H10N6 — CID 16134
2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 16134) has the molecular formula C5H10N6 and a molecular weight of 154.18 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 16134 |
| Molecular Formula | C5H10N6 |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C5H10N6/c1-11(2)5-9-3(6)8-4(7)10-5/h1-2H3,(H4,6,7,8,9,10) |
| InChIKey | IEFWDQQGFDLKFK-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |