C10H16FN2O14P3 — CID 161341459
[[dideuterio-[(2R,4R,5R)-2-fluoro-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 161341459) has the molecular formula C10H16FN2O14P3 and a molecular weight of 502.17 g/mol. Its IUPAC name is [[dideuterio-[(2R,4R,5R)-2-fluoro-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[dideuterio-[(2R,4R,5R)-2-fluoro-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 161341459 |
| Molecular Formula | C10H16FN2O14P3 |
| Molecular Weight | 502.17 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | [[dideuterio-[(2R,4R,5R)-2-fluoro-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [2H]C([2H])(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@]1(F)C[C@@H](O)[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C10H16FN2O14P3/c1-5-3-13(9(16)12-7(5)15)8-6(14)2-10(11,25-8)4-24-29(20,21)27-30(22,23)26-28(17,18)19/h3,6,8,14H,2,4H2,1H3,(H,20,21)(H,22,23)(H,12,15,16)(H2,17,18,19)/t6-,8-,10+/m1/s1/i4D2 |
| InChIKey | ZAYDCMRIGJUFLN-VTWOVGMISA-N |
| XLogP | -0.87 |
| TPSA | 244.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.17 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|