About butane;methane;tricyclo[1.1.0.02,4]butane
butane;methane;tricyclo[1.1.0.02,4]butane (PubChem CID 161341800) has the molecular formula C15H36
and a molecular weight of 216.45 g/mol. Its IUPAC name is butane;methane;tricyclo[1.1.0.02,4]butane.
Molecular Properties
| Compound Name | butane;methane;tricyclo[1.1.0.02,4]butane |
| PubChem CID | 161341800 |
| Molecular Formula | C15H36 |
| Molecular Weight | 216.45 g/mol |
| Exact Mass | 216.28 |
| IUPAC Name | butane;methane;tricyclo[1.1.0.02,4]butane |
| SMILES | C.C.C.C12C3C1C23.CCCC.CCCC |
| InChI | InChI=1S/C4H4.2C4H10.3CH4/c1-2-3(1)4(1)2;2*1-3-4-2;;;/h1-4H;2*3-4H2,1-2H3;3*1H4 |
| InChIKey | VMTNIBPWFDHZPH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butane;methane;tricyclo[1.1.0.02,4]butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;methane;tricyclo[1.1.0.02,4]butane?
The IUPAC name of butane;methane;tricyclo[1.1.0.02,4]butane (CID 161341800) is butane;methane;tricyclo[1.1.0.02,4]butane.
What is the SMILES notation for butane;methane;tricyclo[1.1.0.02,4]butane?
The canonical SMILES for butane;methane;tricyclo[1.1.0.02,4]butane is C.C.C.C12C3C1C23.CCCC.CCCC.
What is the InChIKey of butane;methane;tricyclo[1.1.0.02,4]butane?
The InChIKey is VMTNIBPWFDHZPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4.2C4H10.3CH4/c1-2-3(1)4(1)2;2*1-3-4-2;;;/h1-4H;2*3-4H2,1-2H3;3*1H4.
What are the key properties of butane;methane;tricyclo[1.1.0.02,4]butane?
butane;methane;tricyclo[1.1.0.02,4]butane has a molecular weight of 216.45 g/mol, XLogP of 6.01, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;methane;tricyclo[1.1.0.02,4]butane is sourced from PubChem (CID 161341800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).