C30H50O3 — CID 161342150
3-[(E)-3,3-dimethylbut-1-enyl]-2,4,4-trimethylcyclohex-2-en-1-one;(E)-1-(4-hydroxy-1,2,2-trimethylcyclopentyl)-4,4-dimethylpent-2-en-1-one (PubChem CID 161342150) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is 3-[(E)-3,3-dimethylbut-1-enyl]-2,4,4-trimethylcyclohex-2-en-1-one;(E)-1-(4-hydroxy-1,2,2-trimethylcyclopentyl)-4,4-dimethylpent-2-en-1-one.
| Compound Name | 3-[(E)-3,3-dimethylbut-1-enyl]-2,4,4-trimethylcyclohex-2-en-1-one;(E)-1-(4-hydroxy-1,2,2-trimethylcyclopentyl)-4,4-dimethylpent-2-en-1-one |
|---|---|
| PubChem CID | 161342150 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | 3-[(E)-3,3-dimethylbut-1-enyl]-2,4,4-trimethylcyclohex-2-en-1-one;(E)-1-(4-hydroxy-1,2,2-trimethylcyclopentyl)-4,4-dimethylpent-2-en-1-one |
| SMILES | CC(C)(C)/C=C/C(=O)C1(C)CC(O)CC1(C)C.CC1=C(/C=C/C(C)(C)C)C(C)(C)CCC1=O |
| InChI | InChI=1S/C15H26O2.C15H24O/c1-13(2,3)8-7-12(17)15(6)10-11(16)9-14(15,4)5;1-11-12(7-9-14(2,3)4)15(5,6)10-8-13(11)16/h7-8,11,16H,9-10H2,1-6H3;7,9H,8,10H2,1-6H3/b8-7+;9-7+ |
| InChIKey | VMURYRIYAUSPAF-IFSXZBTESA-N |
| XLogP | 7.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|