C22H44Cl2N6O6 — CID 161343209
tert-butyl N,N-bis(2-aminoethyl)carbamate;tert-butyl N,N-bis[2-[(2-chloroacetyl)amino]ethyl]carbamate (PubChem CID 161343209) has the molecular formula C22H44Cl2N6O6 and a molecular weight of 559.54 g/mol. Its IUPAC name is tert-butyl N,N-bis(2-aminoethyl)carbamate;tert-butyl N,N-bis[2-[(2-chloroacetyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N,N-bis(2-aminoethyl)carbamate;tert-butyl N,N-bis[2-[(2-chloroacetyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 161343209 |
| Molecular Formula | C22H44Cl2N6O6 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | tert-butyl N,N-bis(2-aminoethyl)carbamate;tert-butyl N,N-bis[2-[(2-chloroacetyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCN)CCN.CC(C)(C)OC(=O)N(CCNC(=O)CCl)CCNC(=O)CCl |
| InChI | InChI=1S/C13H23Cl2N3O4.C9H21N3O2/c1-13(2,3)22-12(21)18(6-4-16-10(19)8-14)7-5-17-11(20)9-15;1-9(2,3)14-8(13)12(6-4-10)7-5-11/h4-9H2,1-3H3,(H,16,19)(H,17,20);4-7,10-11H2,1-3H3 |
| InChIKey | VMYHNQPMGBYCEA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 169.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|